DL-2-methylglutamic acid hemihydrate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

DL-2-methylglutamic acid hemihydrate
CAS RN:[71-90-9]
Formula:C6H11NO4; 161.16 g/mol
InChiKey:QHSCIWIRXWFIGH-UHFFFAOYSA-N
SMILES:CC(N)(CCC(O)=O)C(O)=O
Molecular structure of DL-2-methylglutamic acid hemihydrate
Melting point:160 °C

Isomers

2-aminoadipic acid
Molecular structure of 2-aminoadipic acid
L-2-aminoadipic acid
Molecular structure of L-2-aminoadipic acid
(2R)-2-aminohexanedioic acid
Molecular structure of (2R)-2-aminohexanedioic acid
3-(2-carboxyethylamino)propanoic acid
Molecular structure of 3-(2-carboxyethylamino)propanoic acid
2-[carboxymethyl(ethyl)amino]acetic acid
Molecular structure of 2-[carboxymethyl(ethyl)amino]acetic acid
2-[(2-ethoxy-2-oxoethyl)amino]acetic acid
Molecular structure of 2-[(2-ethoxy-2-oxoethyl)amino]acetic acid
DL-2-methylglutamic acid hemihydrate
Molecular structure of DL-2-methylglutamic acid hemihydrate
6-nitrohexanoic acid
Molecular structure of 6-nitrohexanoic acid
  ::